C44H81N3O6 — CID 174321676
2-ethylnonyl 6-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-nonoxynon-8-enyl)amino]hexyl carbonate (PubChem CID 174321676) has the molecular formula C44H81N3O6 and a molecular weight of 748.15 g/mol. Its IUPAC name is 2-ethylnonyl 6-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-nonoxynon-8-enyl)amino]hexyl carbonate.
| Compound Name | 2-ethylnonyl 6-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-nonoxynon-8-enyl)amino]hexyl carbonate |
|---|---|
| PubChem CID | 174321676 |
| Molecular Formula | C44H81N3O6 |
| Molecular Weight | 748.15 g/mol |
| Exact Mass | 747.61 |
| IUPAC Name | 2-ethylnonyl 6-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-nonoxynon-8-enyl)amino]hexyl carbonate |
| SMILES | C=C(CCCCCCCN(CCCCCCOC(=O)OCC(CC)CCCCCCC)CCCNc1c(NC)c(=O)c1=O)OCCCCCCCCC |
| InChI | InChI=1S/C44H81N3O6/c1-6-9-11-13-14-20-26-35-51-38(4)29-22-17-15-18-24-32-47(34-28-31-46-41-40(45-5)42(48)43(41)49)33-25-19-21-27-36-52-44(50)53-37-39(8-3)30-23-16-12-10-7-2/h39,45-46H,4,6-37H2,1-3,5H3 |
| InChIKey | SLCLMMURJDFGBC-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.15 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|