C47H88N4O5 — CID 174321512
2-butylhexyl 8-[[8-imino-8-(3-pentyloctoxy)octyl]-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate (PubChem CID 174321512) has the molecular formula C47H88N4O5 and a molecular weight of 789.24 g/mol. Its IUPAC name is 2-butylhexyl 8-[[8-imino-8-(3-pentyloctoxy)octyl]-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate.
| Compound Name | 2-butylhexyl 8-[[8-imino-8-(3-pentyloctoxy)octyl]-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate |
|---|---|
| PubChem CID | 174321512 |
| Molecular Formula | C47H88N4O5 |
| Molecular Weight | 789.24 g/mol |
| Exact Mass | 788.68 |
| IUPAC Name | 2-butylhexyl 8-[[8-imino-8-(3-pentyloctoxy)octyl]-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate |
| SMILES | [H]/N=C(/CCCCCCCN(CCCCCCCC(=O)OCC(CCCC)CCCC)CCCNc1c(NC)c(=O)c1=O)OCCC(CCCCC)CCCCC |
| InChI | InChI=1S/C47H88N4O5/c1-6-10-20-29-40(30-21-11-7-2)33-38-55-42(48)31-22-16-14-18-24-35-51(37-26-34-50-45-44(49-5)46(53)47(45)54)36-25-19-15-17-23-32-43(52)56-39-41(27-12-8-3)28-13-9-4/h40-41,48-50H,6-39H2,1-5H3/b48-42- |
| InChIKey | XUIHKVKAZJSLKE-LIHZNPIGSA-N |
| XLogP | 11.81 |
| TPSA | 120.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.24 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|