C42H77N3O6 — CID 167418964
2-methylheptyl 8-[(8-decan-5-yloxy-8-oxooctyl)-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate (PubChem CID 167418964) has the molecular formula C42H77N3O6 and a molecular weight of 720.09 g/mol. Its IUPAC name is 2-methylheptyl 8-[(8-decan-5-yloxy-8-oxooctyl)-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate.
| Compound Name | 2-methylheptyl 8-[(8-decan-5-yloxy-8-oxooctyl)-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate |
|---|---|
| PubChem CID | 167418964 |
| Molecular Formula | C42H77N3O6 |
| Molecular Weight | 720.09 g/mol |
| Exact Mass | 719.58 |
| IUPAC Name | 2-methylheptyl 8-[(8-decan-5-yloxy-8-oxooctyl)-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate |
| SMILES | CCCCCC(C)COC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCC)CCCCC)CCCNc1c(NC)c(=O)c1=O |
| InChI | InChI=1S/C42H77N3O6/c1-6-9-18-25-35(4)34-50-37(46)28-20-14-12-16-22-31-45(33-24-30-44-40-39(43-5)41(48)42(40)49)32-23-17-13-15-21-29-38(47)51-36(26-11-8-3)27-19-10-7-2/h35-36,43-44H,6-34H2,1-5H3 |
| InChIKey | FPMXECLMNYIURW-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.09 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|