C39H71N3O6 — CID 146447838
undecan-3-yl 8-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-[8-[(2-methylpropan-2-yl)oxy]-8-oxooctyl]amino]octanoate (PubChem CID 146447838) has the molecular formula C39H71N3O6 and a molecular weight of 678.01 g/mol. Its IUPAC name is undecan-3-yl 8-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-[8-[(2-methylpropan-2-yl)oxy]-8-oxooctyl]amino]octanoate.
| Compound Name | undecan-3-yl 8-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-[8-[(2-methylpropan-2-yl)oxy]-8-oxooctyl]amino]octanoate |
|---|---|
| PubChem CID | 146447838 |
| Molecular Formula | C39H71N3O6 |
| Molecular Weight | 678.01 g/mol |
| Exact Mass | 677.53 |
| IUPAC Name | undecan-3-yl 8-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-[8-[(2-methylpropan-2-yl)oxy]-8-oxooctyl]amino]octanoate |
| SMILES | CCCCCCCCC(CC)OC(=O)CCCCCCCN(CCCCCCCC(=O)OC(C)(C)C)CCCNc1c(NC)c(=O)c1=O |
| InChI | InChI=1S/C39H71N3O6/c1-7-9-10-11-14-19-25-32(8-2)47-33(43)26-20-15-12-17-22-29-42(31-24-28-41-36-35(40-6)37(45)38(36)46)30-23-18-13-16-21-27-34(44)48-39(3,4)5/h32,40-41H,7-31H2,1-6H3 |
| InChIKey | BWOXCLZJROCGLE-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.01 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|