C56H104N2O7 — CID 146475462
undecan-3-yl 8-[[8-[(7R)-7-methylheptadecan-9-yl]oxy-8-oxooctyl]-[3-[[2-[(2-methylpropan-2-yl)oxy]-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate (PubChem CID 146475462) has the molecular formula C56H104N2O7 and a molecular weight of 917.45 g/mol. Its IUPAC name is undecan-3-yl 8-[[8-[(7R)-7-methylheptadecan-9-yl]oxy-8-oxooctyl]-[3-[[2-[(2-methylpropan-2-yl)oxy]-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate.
| Compound Name | undecan-3-yl 8-[[8-[(7R)-7-methylheptadecan-9-yl]oxy-8-oxooctyl]-[3-[[2-[(2-methylpropan-2-yl)oxy]-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate |
|---|---|
| PubChem CID | 146475462 |
| Molecular Formula | C56H104N2O7 |
| Molecular Weight | 917.45 g/mol |
| Exact Mass | 916.78 |
| IUPAC Name | undecan-3-yl 8-[[8-[(7R)-7-methylheptadecan-9-yl]oxy-8-oxooctyl]-[3-[[2-[(2-methylpropan-2-yl)oxy]-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoate |
| SMILES | CCCCCCCCC(CC)OC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)C[C@H](C)CCCCCC)CCCNc1c(OC(C)(C)C)c(=O)c1=O |
| InChI | InChI=1S/C56H104N2O7/c1-9-13-16-19-23-30-38-48(12-4)63-50(59)40-32-25-21-27-34-43-58(45-36-42-57-52-53(61)54(62)55(52)65-56(6,7)8)44-35-28-22-26-33-41-51(60)64-49(39-31-24-20-17-14-10-2)46-47(5)37-29-18-15-11-3/h47-49,57H,9-46H2,1-8H3/t47-,48?,49?/m1/s1 |
| InChIKey | AXWQNPYEBKJRKW-ICCIBUJMSA-N |
| XLogP | 14.98 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.45 |
| LogP ≤ 5 | 14.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|