C54H100N2O4 — CID 174360583
3-[3-[8-heptadecan-9-yloxynon-8-enyl(8-undecan-3-yloxynon-8-enyl)amino]propylamino]-4-methylcyclobut-3-ene-1,2-dione (PubChem CID 174360583) has the molecular formula C54H100N2O4 and a molecular weight of 841.40 g/mol. Its IUPAC name is 3-[3-[8-heptadecan-9-yloxynon-8-enyl(8-undecan-3-yloxynon-8-enyl)amino]propylamino]-4-methylcyclobut-3-ene-1,2-dione.
| Compound Name | 3-[3-[8-heptadecan-9-yloxynon-8-enyl(8-undecan-3-yloxynon-8-enyl)amino]propylamino]-4-methylcyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 174360583 |
| Molecular Formula | C54H100N2O4 |
| Molecular Weight | 841.40 g/mol |
| Exact Mass | 840.77 |
| IUPAC Name | 3-[3-[8-heptadecan-9-yloxynon-8-enyl(8-undecan-3-yloxynon-8-enyl)amino]propylamino]-4-methylcyclobut-3-ene-1,2-dione |
| SMILES | C=C(CCCCCCCN(CCCCCCCC(=C)OC(CCCCCCCC)CCCCCCCC)CCCNc1c(C)c(=O)c1=O)OC(CC)CCCCCCCC |
| InChI | InChI=1S/C54H100N2O4/c1-8-12-15-18-25-32-40-50(11-4)59-47(5)38-30-23-21-28-35-44-56(46-37-43-55-52-49(7)53(57)54(52)58)45-36-29-22-24-31-39-48(6)60-51(41-33-26-19-16-13-9-2)42-34-27-20-17-14-10-3/h50-51,55H,5-6,8-46H2,1-4,7H3 |
| InChIKey | WAFIMONEGIULLX-UHFFFAOYSA-N |
| XLogP | 15.84 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.40 |
| LogP ≤ 5 | 15.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|