C53H99N3O6 — CID 139376724
nonyl 8-[3-[[2-(diethylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 139376724) has the molecular formula C53H99N3O6 and a molecular weight of 874.39 g/mol. Its IUPAC name is nonyl 8-[3-[[2-(diethylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | nonyl 8-[3-[[2-(diethylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 139376724 |
| Molecular Formula | C53H99N3O6 |
| Molecular Weight | 874.39 g/mol |
| Exact Mass | 873.75 |
| IUPAC Name | nonyl 8-[3-[[2-(diethylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCNc1c(N(CC)CC)c(=O)c1=O |
| InChI | InChI=1S/C53H99N3O6/c1-6-11-14-17-20-29-36-46-61-48(57)40-32-25-21-27-34-43-55(45-37-42-54-50-51(53(60)52(50)59)56(9-4)10-5)44-35-28-22-26-33-41-49(58)62-47(38-30-23-18-15-12-7-2)39-31-24-19-16-13-8-3/h47,54H,6-46H2,1-5H3 |
| InChIKey | JEONERSBZXPDPZ-UHFFFAOYSA-N |
| XLogP | 13.62 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.39 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|