C52H96N2O7 — CID 174324892
heptadecan-9-yl 8-[3-[(3,4-dioxo-2-propylcyclobuten-1-yl)amino]propyl-(5-methyl-6-nonoxycarbonyloxyhexyl)amino]octanoate (PubChem CID 174324892) has the molecular formula C52H96N2O7 and a molecular weight of 861.35 g/mol. Its IUPAC name is heptadecan-9-yl 8-[3-[(3,4-dioxo-2-propylcyclobuten-1-yl)amino]propyl-(5-methyl-6-nonoxycarbonyloxyhexyl)amino]octanoate.
| Compound Name | heptadecan-9-yl 8-[3-[(3,4-dioxo-2-propylcyclobuten-1-yl)amino]propyl-(5-methyl-6-nonoxycarbonyloxyhexyl)amino]octanoate |
|---|---|
| PubChem CID | 174324892 |
| Molecular Formula | C52H96N2O7 |
| Molecular Weight | 861.35 g/mol |
| Exact Mass | 860.72 |
| IUPAC Name | heptadecan-9-yl 8-[3-[(3,4-dioxo-2-propylcyclobuten-1-yl)amino]propyl-(5-methyl-6-nonoxycarbonyloxyhexyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)OCC(C)CCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCNc1c(CCC)c(=O)c1=O |
| InChI | InChI=1S/C52H96N2O7/c1-6-10-13-16-19-25-32-43-59-52(58)60-44-45(5)35-29-31-41-54(42-33-39-53-49-47(34-9-4)50(56)51(49)57)40-30-24-20-23-28-38-48(55)61-46(36-26-21-17-14-11-7-2)37-27-22-18-15-12-8-3/h45-46,53H,6-44H2,1-5H3 |
| InChIKey | GBNYZJXWHSTLBH-UHFFFAOYSA-N |
| XLogP | 13.80 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.35 |
| LogP ≤ 5 | 13.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|