C54H105N3O6 — CID 177064223
ethane;9-methoxyheptadecane;2-methylnonyl 8-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-oxooctyl)amino]octanoate (PubChem CID 177064223) has the molecular formula C54H105N3O6 and a molecular weight of 892.45 g/mol. Its IUPAC name is ethane;9-methoxyheptadecane;2-methylnonyl 8-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-oxooctyl)amino]octanoate.
| Compound Name | ethane;9-methoxyheptadecane;2-methylnonyl 8-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 177064223 |
| Molecular Formula | C54H105N3O6 |
| Molecular Weight | 892.45 g/mol |
| Exact Mass | 891.80 |
| IUPAC Name | ethane;9-methoxyheptadecane;2-methylnonyl 8-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-oxooctyl)amino]octanoate |
| SMILES | CC.CCCCCCCC(C)COC(=O)CCCCCCCN(CCCCCCCC=O)CCCNc1c(NC)c(=O)c1=O.CCCCCCCCC(CCCCCCCC)OC |
| InChI | InChI=1S/C34H61N3O5.C18H38O.C2H6/c1-4-5-6-10-15-21-29(2)28-42-30(39)22-16-11-9-13-18-25-37(24-17-12-7-8-14-19-27-38)26-20-23-36-32-31(35-3)33(40)34(32)41;1-4-6-8-10-12-14-16-18(19-3)17-15-13-11-9-7-5-2;1-2/h27,29,35-36H,4-26,28H2,1-3H3;18H,4-17H2,1-3H3;1-2H3 |
| InChIKey | ZHYOZYISBPBELJ-UHFFFAOYSA-N |
| XLogP | 14.38 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.45 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|