C31H55N3O5 — CID 155720005
7-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-oxooctyl)amino]heptyl octanoate (PubChem CID 155720005) has the molecular formula C31H55N3O5 and a molecular weight of 549.80 g/mol. Its IUPAC name is 7-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-oxooctyl)amino]heptyl octanoate.
| Compound Name | 7-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-oxooctyl)amino]heptyl octanoate |
|---|---|
| PubChem CID | 155720005 |
| Molecular Formula | C31H55N3O5 |
| Molecular Weight | 549.80 g/mol |
| Exact Mass | 549.41 |
| IUPAC Name | 7-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-(8-oxooctyl)amino]heptyl octanoate |
| SMILES | CCCCCCCC(=O)OCCCCCCCN(CCCCCCCC=O)CCCNc1c(NC)c(=O)c1=O |
| InChI | InChI=1S/C31H55N3O5/c1-3-4-5-9-14-20-27(36)39-26-18-13-8-11-16-23-34(22-15-10-6-7-12-17-25-35)24-19-21-33-29-28(32-2)30(37)31(29)38/h25,32-33H,3-24,26H2,1-2H3 |
| InChIKey | KZRYQQKVMNIDAL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.80 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|