C48H91N3O6 — CID 170756734
7-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-octylamino]heptyl 2-hexylnonanoate;nonyl formate (PubChem CID 170756734) has the molecular formula C48H91N3O6 and a molecular weight of 806.27 g/mol. Its IUPAC name is 7-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-octylamino]heptyl 2-hexylnonanoate;nonyl formate.
| Compound Name | 7-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-octylamino]heptyl 2-hexylnonanoate;nonyl formate |
|---|---|
| PubChem CID | 170756734 |
| Molecular Formula | C48H91N3O6 |
| Molecular Weight | 806.27 g/mol |
| Exact Mass | 805.69 |
| IUPAC Name | 7-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl-octylamino]heptyl 2-hexylnonanoate;nonyl formate |
| SMILES | CCCCCCCCCOC=O.CCCCCCCCN(CCCCCCCOC(=O)C(CCCCCC)CCCCCCC)CCCNc1c(NC)c(=O)c1=O |
| InChI | InChI=1S/C38H71N3O4.C10H20O2/c1-5-8-11-14-17-22-29-41(31-25-28-40-35-34(39-4)36(42)37(35)43)30-23-18-15-19-24-32-45-38(44)33(26-20-13-10-7-3)27-21-16-12-9-6-2;1-2-3-4-5-6-7-8-9-12-10-11/h33,39-40H,5-32H2,1-4H3;10H,2-9H2,1H3 |
| InChIKey | UVVSBTSFSAPGSG-UHFFFAOYSA-N |
| XLogP | 12.14 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.27 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|