C22H41N3O2 — CID 155720132
3-[3-[hexyl(octyl)amino]propylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione (PubChem CID 155720132) has the molecular formula C22H41N3O2 and a molecular weight of 379.59 g/mol. Its IUPAC name is 3-[3-[hexyl(octyl)amino]propylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[3-[hexyl(octyl)amino]propylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 155720132 |
| Molecular Formula | C22H41N3O2 |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.32 |
| IUPAC Name | 3-[3-[hexyl(octyl)amino]propylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione |
| SMILES | CCCCCCCCN(CCCCCC)CCCNc1c(NC)c(=O)c1=O |
| InChI | InChI=1S/C22H41N3O2/c1-4-6-8-10-11-13-17-25(16-12-9-7-5-2)18-14-15-24-20-19(23-3)21(26)22(20)27/h23-24H,4-18H2,1-3H3 |
| InChIKey | ILLVKHBWSHJNAB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|