C47H91N3O3 — CID 170755307
3-[3-[3-(4-ethyldecoxy)propyl-(8-octylhexadecyl)amino]propylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione (PubChem CID 170755307) has the molecular formula C47H91N3O3 and a molecular weight of 746.26 g/mol. Its IUPAC name is 3-[3-[3-(4-ethyldecoxy)propyl-(8-octylhexadecyl)amino]propylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[3-[3-(4-ethyldecoxy)propyl-(8-octylhexadecyl)amino]propylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 170755307 |
| Molecular Formula | C47H91N3O3 |
| Molecular Weight | 746.26 g/mol |
| Exact Mass | 745.71 |
| IUPAC Name | 3-[3-[3-(4-ethyldecoxy)propyl-(8-octylhexadecyl)amino]propylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione |
| SMILES | CCCCCCCCC(CCCCCCCC)CCCCCCCN(CCCNc1c(NC)c(=O)c1=O)CCCOCCCC(CC)CCCCCC |
| InChI | InChI=1S/C47H91N3O3/c1-6-10-13-16-19-24-32-43(33-25-20-17-14-11-7-2)34-26-21-18-22-27-37-50(38-29-36-49-45-44(48-5)46(51)47(45)52)39-30-41-53-40-28-35-42(9-4)31-23-15-12-8-3/h42-43,48-49H,6-41H2,1-5H3 |
| InChIKey | VGSSJGCTTADBKC-UHFFFAOYSA-N |
| XLogP | 13.07 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.26 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|