C46H88N2O2 — CID 177193880
3-[3-[10-butyltetradecyl(9-pentyltetradecyl)amino]propylamino]-4-ethylcyclobut-3-ene-1,2-dione (PubChem CID 177193880) has the molecular formula C46H88N2O2 and a molecular weight of 701.22 g/mol. Its IUPAC name is 3-[3-[10-butyltetradecyl(9-pentyltetradecyl)amino]propylamino]-4-ethylcyclobut-3-ene-1,2-dione.
| Compound Name | 3-[3-[10-butyltetradecyl(9-pentyltetradecyl)amino]propylamino]-4-ethylcyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 177193880 |
| Molecular Formula | C46H88N2O2 |
| Molecular Weight | 701.22 g/mol |
| Exact Mass | 700.68 |
| IUPAC Name | 3-[3-[10-butyltetradecyl(9-pentyltetradecyl)amino]propylamino]-4-ethylcyclobut-3-ene-1,2-dione |
| SMILES | CCCCCC(CCCCC)CCCCCCCCN(CCCCCCCCCC(CCCC)CCCC)CCCNc1c(CC)c(=O)c1=O |
| InChI | InChI=1S/C46H88N2O2/c1-6-11-24-33-42(34-25-12-7-2)36-27-21-17-19-23-29-39-48(40-30-37-47-44-43(10-5)45(49)46(44)50)38-28-22-18-15-16-20-26-35-41(31-13-8-3)32-14-9-4/h41-42,47H,6-40H2,1-5H3 |
| InChIKey | UIDVIDVURSNPHJ-UHFFFAOYSA-N |
| XLogP | 13.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.22 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|