C56H103N3O6 — CID 174324597
(E)-9-[[2-[2-(dioctylamino)ethylamino]-3,4-dioxocyclobuten-1-yl]-(8-heptadecan-9-yloxy-8-oxooctyl)amino]non-8-enoic acid (PubChem CID 174324597) has the molecular formula C56H103N3O6 and a molecular weight of 914.45 g/mol. Its IUPAC name is (E)-9-[[2-[2-(dioctylamino)ethylamino]-3,4-dioxocyclobuten-1-yl]-(8-heptadecan-9-yloxy-8-oxooctyl)amino]non-8-enoic acid.
| Compound Name | (E)-9-[[2-[2-(dioctylamino)ethylamino]-3,4-dioxocyclobuten-1-yl]-(8-heptadecan-9-yloxy-8-oxooctyl)amino]non-8-enoic acid |
|---|---|
| PubChem CID | 174324597 |
| Molecular Formula | C56H103N3O6 |
| Molecular Weight | 914.45 g/mol |
| Exact Mass | 913.78 |
| IUPAC Name | (E)-9-[[2-[2-(dioctylamino)ethylamino]-3,4-dioxocyclobuten-1-yl]-(8-heptadecan-9-yloxy-8-oxooctyl)amino]non-8-enoic acid |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(/C=C/CCCCCCC(=O)O)c1c(NCCN(CCCCCCCC)CCCCCCCC)c(=O)c1=O |
| InChI | InChI=1S/C56H103N3O6/c1-5-9-13-17-24-32-40-50(41-33-25-18-14-10-6-2)65-52(62)43-35-27-23-31-39-48-59(47-38-30-22-21-26-34-42-51(60)61)54-53(55(63)56(54)64)57-44-49-58(45-36-28-19-15-11-7-3)46-37-29-20-16-12-8-4/h38,47,50,57H,5-37,39-46,48-49H2,1-4H3,(H,60,61)/b47-38+ |
| InChIKey | OMPZWBQLWDPRES-GSZZHRNKSA-N |
| XLogP | 15.22 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.45 |
| LogP ≤ 5 | 15.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|