C43H77N3O7 — CID 170754908
8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[2-(oxetan-3-ylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoic acid (PubChem CID 170754908) has the molecular formula C43H77N3O7 and a molecular weight of 748.10 g/mol. Its IUPAC name is 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[2-(oxetan-3-ylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoic acid.
| Compound Name | 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[2-(oxetan-3-ylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoic acid |
|---|---|
| PubChem CID | 170754908 |
| Molecular Formula | C43H77N3O7 |
| Molecular Weight | 748.10 g/mol |
| Exact Mass | 747.58 |
| IUPAC Name | 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[2-(oxetan-3-ylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]amino]octanoic acid |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCCCCCC(=O)O)CCCNc1c(NC2COC2)c(=O)c1=O |
| InChI | InChI=1S/C43H77N3O7/c1-3-5-7-9-13-19-26-37(27-20-14-10-8-6-4-2)53-39(49)29-22-16-12-18-24-32-46(31-23-17-11-15-21-28-38(47)48)33-25-30-44-40-41(43(51)42(40)50)45-36-34-52-35-36/h36-37,44-45H,3-35H2,1-2H3,(H,47,48) |
| InChIKey | KFNRKGSZSWBYFT-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.10 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|