C42H79N3O5 — CID 170759317
8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[4-methyl-2-(methylamino)-3-oxocyclobuten-1-yl]amino]propyl]amino]octanoic acid (PubChem CID 170759317) has the molecular formula C42H79N3O5 and a molecular weight of 706.11 g/mol. Its IUPAC name is 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[4-methyl-2-(methylamino)-3-oxocyclobuten-1-yl]amino]propyl]amino]octanoic acid.
| Compound Name | 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[4-methyl-2-(methylamino)-3-oxocyclobuten-1-yl]amino]propyl]amino]octanoic acid |
|---|---|
| PubChem CID | 170759317 |
| Molecular Formula | C42H79N3O5 |
| Molecular Weight | 706.11 g/mol |
| Exact Mass | 705.60 |
| IUPAC Name | 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[4-methyl-2-(methylamino)-3-oxocyclobuten-1-yl]amino]propyl]amino]octanoic acid |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCCCCCC(=O)O)CCCNC1=C(NC)C(=O)C1C |
| InChI | InChI=1S/C42H79N3O5/c1-5-7-9-11-15-21-28-37(29-22-16-12-10-8-6-2)50-39(48)31-24-18-14-20-26-34-45(33-25-19-13-17-23-30-38(46)47)35-27-32-44-40-36(3)42(49)41(40)43-4/h36-37,43-44H,5-35H2,1-4H3,(H,46,47) |
| InChIKey | ZLATZUZBSOYCIG-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.11 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|