C54H103N3O4 — CID 170755191
heptadecan-9-yl 8-[3-[[2-(methylamino)-3-methylidene-4-oxocyclobuten-1-yl]amino]propyl-[8-[(3R)-undecan-3-yl]oxynonyl]amino]octanoate (PubChem CID 170755191) has the molecular formula C54H103N3O4 and a molecular weight of 858.43 g/mol. Its IUPAC name is heptadecan-9-yl 8-[3-[[2-(methylamino)-3-methylidene-4-oxocyclobuten-1-yl]amino]propyl-[8-[(3R)-undecan-3-yl]oxynonyl]amino]octanoate.
| Compound Name | heptadecan-9-yl 8-[3-[[2-(methylamino)-3-methylidene-4-oxocyclobuten-1-yl]amino]propyl-[8-[(3R)-undecan-3-yl]oxynonyl]amino]octanoate |
|---|---|
| PubChem CID | 170755191 |
| Molecular Formula | C54H103N3O4 |
| Molecular Weight | 858.43 g/mol |
| Exact Mass | 857.79 |
| IUPAC Name | heptadecan-9-yl 8-[3-[[2-(methylamino)-3-methylidene-4-oxocyclobuten-1-yl]amino]propyl-[8-[(3R)-undecan-3-yl]oxynonyl]amino]octanoate |
| SMILES | C=C1C(=O)C(NCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCCCCCC(C)O[C@H](CC)CCCCCCCC)=C1NC |
| InChI | InChI=1S/C54H103N3O4/c1-8-12-15-18-24-31-39-49(11-4)60-47(5)38-30-23-21-28-35-44-57(46-37-43-56-53-52(55-7)48(6)54(53)59)45-36-29-22-27-34-42-51(58)61-50(40-32-25-19-16-13-9-2)41-33-26-20-17-14-10-3/h47,49-50,55-56H,6,8-46H2,1-5,7H3/t47?,49-/m1/s1 |
| InChIKey | JBOPERVNQLJHAP-KFHZWEFBSA-N |
| XLogP | 14.87 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.43 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|