C53H99N3O6 — CID 176693310
undecan-3-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[3-(methylamino)-4-oxo-6-oxabicyclo[3.1.0]hex-2-en-2-yl]amino]propyl]amino]octanoate (PubChem CID 176693310) has the molecular formula C53H99N3O6 and a molecular weight of 874.39 g/mol. Its IUPAC name is undecan-3-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[3-(methylamino)-4-oxo-6-oxabicyclo[3.1.0]hex-2-en-2-yl]amino]propyl]amino]octanoate.
| Compound Name | undecan-3-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[3-(methylamino)-4-oxo-6-oxabicyclo[3.1.0]hex-2-en-2-yl]amino]propyl]amino]octanoate |
|---|---|
| PubChem CID | 176693310 |
| Molecular Formula | C53H99N3O6 |
| Molecular Weight | 874.39 g/mol |
| Exact Mass | 873.75 |
| IUPAC Name | undecan-3-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[[3-(methylamino)-4-oxo-6-oxabicyclo[3.1.0]hex-2-en-2-yl]amino]propyl]amino]octanoate |
| SMILES | CCCCCCCCC(CC)OC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCNC1=C(NC)C(=O)C2OC12 |
| InChI | InChI=1S/C53H99N3O6/c1-6-10-13-16-21-28-36-45(9-4)60-47(57)39-31-24-19-26-33-42-56(44-35-41-55-50-49(54-5)51(59)53-52(50)62-53)43-34-27-20-25-32-40-48(58)61-46(37-29-22-17-14-11-7-2)38-30-23-18-15-12-8-3/h45-46,52-55H,6-44H2,1-5H3 |
| InChIKey | LACSBGRUZJBYBV-UHFFFAOYSA-N |
| XLogP | 13.22 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.39 |
| LogP ≤ 5 | 13.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|