C50H97N3O4S2 — CID 174321268
heptadecan-9-yl 8-[7-(decyldisulfanyl)heptyl-[3-[[3-hydroxy-2-(methylamino)-4-oxocyclobuten-1-yl]amino]propyl]amino]octanoate (PubChem CID 174321268) has the molecular formula C50H97N3O4S2 and a molecular weight of 868.48 g/mol. Its IUPAC name is heptadecan-9-yl 8-[7-(decyldisulfanyl)heptyl-[3-[[3-hydroxy-2-(methylamino)-4-oxocyclobuten-1-yl]amino]propyl]amino]octanoate.
| Compound Name | heptadecan-9-yl 8-[7-(decyldisulfanyl)heptyl-[3-[[3-hydroxy-2-(methylamino)-4-oxocyclobuten-1-yl]amino]propyl]amino]octanoate |
|---|---|
| PubChem CID | 174321268 |
| Molecular Formula | C50H97N3O4S2 |
| Molecular Weight | 868.48 g/mol |
| Exact Mass | 867.69 |
| IUPAC Name | heptadecan-9-yl 8-[7-(decyldisulfanyl)heptyl-[3-[[3-hydroxy-2-(methylamino)-4-oxocyclobuten-1-yl]amino]propyl]amino]octanoate |
| SMILES | CCCCCCCCCCSSCCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCNC1=C(NC)C(O)C1=O |
| InChI | InChI=1S/C50H97N3O4S2/c1-5-8-11-14-17-18-26-33-43-58-59-44-34-27-20-25-32-41-53(42-35-39-52-48-47(51-4)49(55)50(48)56)40-31-24-19-23-30-38-46(54)57-45(36-28-21-15-12-9-6-2)37-29-22-16-13-10-7-3/h45,49,51-52,55H,5-44H2,1-4H3 |
| InChIKey | DTNZKNHEISRBMX-UHFFFAOYSA-N |
| XLogP | 13.87 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.48 |
| LogP ≤ 5 | 13.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|