C32H64N2O4 — CID 177094272
heptadecan-9-yl 6-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butylamino]hexanoate (PubChem CID 177094272) has the molecular formula C32H64N2O4 and a molecular weight of 540.87 g/mol. Its IUPAC name is heptadecan-9-yl 6-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butylamino]hexanoate.
| Compound Name | heptadecan-9-yl 6-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butylamino]hexanoate |
|---|---|
| PubChem CID | 177094272 |
| Molecular Formula | C32H64N2O4 |
| Molecular Weight | 540.87 g/mol |
| Exact Mass | 540.49 |
| IUPAC Name | heptadecan-9-yl 6-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butylamino]hexanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCNCCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H64N2O4/c1-6-8-10-12-14-17-23-29(24-18-15-13-11-9-7-2)37-30(35)25-19-16-20-26-33-27-21-22-28-34-31(36)38-32(3,4)5/h29,33H,6-28H2,1-5H3,(H,34,36) |
| InChIKey | CWIPWGIWMUNFBQ-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.87 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|