C27H54N2O6 — CID 162191362
octan-4-yl 3-aminopropanoate;octan-4-yl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 162191362) has the molecular formula C27H54N2O6 and a molecular weight of 502.74 g/mol. Its IUPAC name is octan-4-yl 3-aminopropanoate;octan-4-yl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | octan-4-yl 3-aminopropanoate;octan-4-yl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 162191362 |
| Molecular Formula | C27H54N2O6 |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.40 |
| IUPAC Name | octan-4-yl 3-aminopropanoate;octan-4-yl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CCCCC(CCC)OC(=O)CCN.CCCCC(CCC)OC(=O)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H31NO4.C11H23NO2/c1-6-8-10-13(9-7-2)20-14(18)11-12-17-15(19)21-16(3,4)5;1-3-5-7-10(6-4-2)14-11(13)8-9-12/h13H,6-12H2,1-5H3,(H,17,19);10H,3-9,12H2,1-2H3 |
| InChIKey | ZQIOVTZKEMHOQN-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|