C53H104N2O6 — CID 146447839
undecan-3-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl]amino]octanoate (PubChem CID 146447839) has the molecular formula C53H104N2O6 and a molecular weight of 865.42 g/mol. Its IUPAC name is undecan-3-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl]amino]octanoate.
| Compound Name | undecan-3-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl]amino]octanoate |
|---|---|
| PubChem CID | 146447839 |
| Molecular Formula | C53H104N2O6 |
| Molecular Weight | 865.42 g/mol |
| Exact Mass | 864.79 |
| IUPAC Name | undecan-3-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl]amino]octanoate |
| SMILES | CCCCCCCCC(CC)OC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C53H104N2O6/c1-9-13-16-19-24-31-39-48(12-4)59-50(56)42-34-27-22-29-36-45-55(47-38-44-54(8)52(58)61-53(5,6)7)46-37-30-23-28-35-43-51(57)60-49(40-32-25-20-17-14-10-2)41-33-26-21-18-15-11-3/h48-49H,9-47H2,1-8H3 |
| InChIKey | SYNFNZVGJUYJKH-UHFFFAOYSA-N |
| XLogP | 15.71 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.42 |
| LogP ≤ 5 | 15.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|