C30H60N2O4 — CID 146447905
8-[3-aminopropyl-(8-oxo-8-undecan-3-yloxyoctyl)amino]octanoic acid (PubChem CID 146447905) has the molecular formula C30H60N2O4 and a molecular weight of 512.82 g/mol. Its IUPAC name is 8-[3-aminopropyl-(8-oxo-8-undecan-3-yloxyoctyl)amino]octanoic acid.
| Compound Name | 8-[3-aminopropyl-(8-oxo-8-undecan-3-yloxyoctyl)amino]octanoic acid |
|---|---|
| PubChem CID | 146447905 |
| Molecular Formula | C30H60N2O4 |
| Molecular Weight | 512.82 g/mol |
| Exact Mass | 512.46 |
| IUPAC Name | 8-[3-aminopropyl-(8-oxo-8-undecan-3-yloxyoctyl)amino]octanoic acid |
| SMILES | CCCCCCCCC(CC)OC(=O)CCCCCCCN(CCCN)CCCCCCCC(=O)O |
| InChI | InChI=1S/C30H60N2O4/c1-3-5-6-7-10-15-21-28(4-2)36-30(35)23-17-12-9-14-19-26-32(27-20-24-31)25-18-13-8-11-16-22-29(33)34/h28H,3-27,31H2,1-2H3,(H,33,34) |
| InChIKey | JHXCCKUVMUONOG-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.82 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|