About nonan-3-yl 9-[3-aminopropyl-(9-nonan-3-yloxy-9-oxononyl)amino]nonanoate
nonan-3-yl 9-[3-aminopropyl-(9-nonan-3-yloxy-9-oxononyl)amino]nonanoate (PubChem CID 168955546) has the molecular formula C39H78N2O4
and a molecular weight of 639.06 g/mol. Its IUPAC name is nonan-3-yl 9-[3-aminopropyl-(9-nonan-3-yloxy-9-oxononyl)amino]nonanoate.
Molecular Properties
| Compound Name | nonan-3-yl 9-[3-aminopropyl-(9-nonan-3-yloxy-9-oxononyl)amino]nonanoate |
| PubChem CID | 168955546 |
| Molecular Formula | C39H78N2O4 |
| Molecular Weight | 639.06 g/mol |
| Exact Mass | 638.60 |
| IUPAC Name | nonan-3-yl 9-[3-aminopropyl-(9-nonan-3-yloxy-9-oxononyl)amino]nonanoate |
| SMILES | CCCCCCC(CC)OC(=O)CCCCCCCCN(CCCN)CCCCCCCCC(=O)OC(CC)CCCCCC |
| InChI | InChI=1S/C39H78N2O4/c1-5-9-11-21-28-36(7-3)44-38(42)30-23-17-13-15-19-25-33-41(35-27-32-40)34-26-20-16-14-18-24-31-39(43)45-37(8-4)29-22-12-10-6-2/h36-37H,5-35,40H2,1-4H3 |
| InChIKey | CCPDWZZZYIUAEP-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 639.06 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze nonan-3-yl 9-[3-aminopropyl-(9-nonan-3-yloxy-9-oxononyl)amino]nonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonan-3-yl 9-[3-aminopropyl-(9-nonan-3-yloxy-9-oxononyl)amino]nonanoate?
The IUPAC name of nonan-3-yl 9-[3-aminopropyl-(9-nonan-3-yloxy-9-oxononyl)amino]nonanoate (CID 168955546) is nonan-3-yl 9-[3-aminopropyl-(9-nonan-3-yloxy-9-oxononyl)amino]nonanoate.
What is the SMILES notation for nonan-3-yl 9-[3-aminopropyl-(9-nonan-3-yloxy-9-oxononyl)amino]nonanoate?
The canonical SMILES for nonan-3-yl 9-[3-aminopropyl-(9-nonan-3-yloxy-9-oxononyl)amino]nonanoate is CCCCCCC(CC)OC(=O)CCCCCCCCN(CCCN)CCCCCCCCC(=O)OC(CC)CCCCCC.
What is the InChIKey of nonan-3-yl 9-[3-aminopropyl-(9-nonan-3-yloxy-9-oxononyl)amino]nonanoate?
The InChIKey is CCPDWZZZYIUAEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H78N2O4/c1-5-9-11-21-28-36(7-3)44-38(42)30-23-17-13-15-19-25-33-41(35-27-32-40)34-26-20-16-14-18-24-31-39(43)45-37(8-4)29-22-12-10-6-2/h36-37H,5-35,40H2,1-4H3.
What are the key properties of nonan-3-yl 9-[3-aminopropyl-(9-nonan-3-yloxy-9-oxononyl)amino]nonanoate?
nonan-3-yl 9-[3-aminopropyl-(9-nonan-3-yloxy-9-oxononyl)amino]nonanoate has a molecular weight of 639.06 g/mol, XLogP of 10.68, 35 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for nonan-3-yl 9-[3-aminopropyl-(9-nonan-3-yloxy-9-oxononyl)amino]nonanoate is sourced from PubChem (CID 168955546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).