C36H72N2O3 — CID 146475457
heptadecan-9-yl 8-[3-aminopropyl(8-oxooctyl)amino]octanoate (PubChem CID 146475457) has the molecular formula C36H72N2O3 and a molecular weight of 580.98 g/mol. Its IUPAC name is heptadecan-9-yl 8-[3-aminopropyl(8-oxooctyl)amino]octanoate.
| Compound Name | heptadecan-9-yl 8-[3-aminopropyl(8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 146475457 |
| Molecular Formula | C36H72N2O3 |
| Molecular Weight | 580.98 g/mol |
| Exact Mass | 580.55 |
| IUPAC Name | heptadecan-9-yl 8-[3-aminopropyl(8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCN)CCCCCCCC=O |
| InChI | InChI=1S/C36H72N2O3/c1-3-5-7-9-14-20-27-35(28-21-15-10-8-6-4-2)41-36(40)29-22-16-13-18-24-32-38(33-26-30-37)31-23-17-11-12-19-25-34-39/h34-35H,3-33,37H2,1-2H3 |
| InChIKey | XKAXBLDDPPPMOY-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.98 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|