C30H59NO4 — CID 155720171
undecan-4-yl 8-[3-hydroxypropyl(8-oxooctyl)amino]octanoate (PubChem CID 155720171) has the molecular formula C30H59NO4 and a molecular weight of 497.81 g/mol. Its IUPAC name is undecan-4-yl 8-[3-hydroxypropyl(8-oxooctyl)amino]octanoate.
| Compound Name | undecan-4-yl 8-[3-hydroxypropyl(8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 155720171 |
| Molecular Formula | C30H59NO4 |
| Molecular Weight | 497.81 g/mol |
| Exact Mass | 497.44 |
| IUPAC Name | undecan-4-yl 8-[3-hydroxypropyl(8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCC(CCC)OC(=O)CCCCCCCN(CCCO)CCCCCCCC=O |
| InChI | InChI=1S/C30H59NO4/c1-3-5-6-10-15-22-29(21-4-2)35-30(34)23-16-11-9-13-18-25-31(26-20-28-33)24-17-12-7-8-14-19-27-32/h27,29,33H,3-26,28H2,1-2H3 |
| InChIKey | GBWNUTHRLLVYQL-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.81 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|