C46H92N2O4 — CID 135329776
2-methylnonyl 8-[3-aminopropyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 135329776) has the molecular formula C46H92N2O4 and a molecular weight of 737.25 g/mol. Its IUPAC name is 2-methylnonyl 8-[3-aminopropyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | 2-methylnonyl 8-[3-aminopropyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 135329776 |
| Molecular Formula | C46H92N2O4 |
| Molecular Weight | 737.25 g/mol |
| Exact Mass | 736.71 |
| IUPAC Name | 2-methylnonyl 8-[3-aminopropyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCN)CCCCCCCC(=O)OCC(C)CCCCCCC |
| InChI | InChI=1S/C46H92N2O4/c1-5-8-11-14-19-26-34-44(35-27-20-15-12-9-6-2)52-46(50)37-29-22-17-24-31-40-48(41-32-38-47)39-30-23-16-21-28-36-45(49)51-42-43(4)33-25-18-13-10-7-3/h43-44H,5-42,47H2,1-4H3 |
| InChIKey | MUSBGIMSBWQHTE-UHFFFAOYSA-N |
| XLogP | 13.27 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.25 |
| LogP ≤ 5 | 13.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|