C45H89NO4 — CID 170755185
2-methylnonyl 8-[ethyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 170755185) has the molecular formula C45H89NO4 and a molecular weight of 708.21 g/mol. Its IUPAC name is 2-methylnonyl 8-[ethyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | 2-methylnonyl 8-[ethyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 170755185 |
| Molecular Formula | C45H89NO4 |
| Molecular Weight | 708.21 g/mol |
| Exact Mass | 707.68 |
| IUPAC Name | 2-methylnonyl 8-[ethyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CC)CCCCCCCC(=O)OCC(C)CCCCCCC |
| InChI | InChI=1S/C45H89NO4/c1-6-10-13-16-21-28-35-43(36-29-22-17-14-11-7-2)50-45(48)38-31-24-19-26-33-40-46(9-4)39-32-25-18-23-30-37-44(47)49-41-42(5)34-27-20-15-12-8-3/h42-43H,6-41H2,1-5H3 |
| InChIKey | DRXGZVLPSIDKHI-UHFFFAOYSA-N |
| XLogP | 13.94 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.21 |
| LogP ≤ 5 | 13.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|