C47H90BrNO6 — CID 146483772
heptadecan-9-yl 8-[2-(8-bromooctanoyloxy)ethyl-[8-[(2-methylpropan-2-yl)oxy]-8-oxooctyl]amino]octanoate (PubChem CID 146483772) has the molecular formula C47H90BrNO6 and a molecular weight of 845.14 g/mol. Its IUPAC name is heptadecan-9-yl 8-[2-(8-bromooctanoyloxy)ethyl-[8-[(2-methylpropan-2-yl)oxy]-8-oxooctyl]amino]octanoate.
| Compound Name | heptadecan-9-yl 8-[2-(8-bromooctanoyloxy)ethyl-[8-[(2-methylpropan-2-yl)oxy]-8-oxooctyl]amino]octanoate |
|---|---|
| PubChem CID | 146483772 |
| Molecular Formula | C47H90BrNO6 |
| Molecular Weight | 845.14 g/mol |
| Exact Mass | 843.60 |
| IUPAC Name | heptadecan-9-yl 8-[2-(8-bromooctanoyloxy)ethyl-[8-[(2-methylpropan-2-yl)oxy]-8-oxooctyl]amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCCCCCC(=O)OC(C)(C)C)CCOC(=O)CCCCCCCBr |
| InChI | InChI=1S/C47H90BrNO6/c1-6-8-10-12-17-25-33-43(34-26-18-13-11-9-7-2)54-45(51)36-28-20-15-23-31-39-49(41-42-53-44(50)35-27-19-14-22-30-38-48)40-32-24-16-21-29-37-46(52)55-47(3,4)5/h43H,6-42H2,1-5H3 |
| InChIKey | KWTYQOZHTKKLLC-UHFFFAOYSA-N |
| XLogP | 14.00 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.14 |
| LogP ≤ 5 | 14.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|