C41H82N2O4 — CID 155278526
hexadecan-8-yl 8-[[8-[hexyl(methyl)amino]-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate (PubChem CID 155278526) has the molecular formula C41H82N2O4 and a molecular weight of 667.12 g/mol. Its IUPAC name is hexadecan-8-yl 8-[[8-[hexyl(methyl)amino]-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate.
| Compound Name | hexadecan-8-yl 8-[[8-[hexyl(methyl)amino]-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate |
|---|---|
| PubChem CID | 155278526 |
| Molecular Formula | C41H82N2O4 |
| Molecular Weight | 667.12 g/mol |
| Exact Mass | 666.63 |
| IUPAC Name | hexadecan-8-yl 8-[[8-[hexyl(methyl)amino]-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCC)OC(=O)CCCCCCCN(CCO)CCCCCCCC(=O)N(C)CCCCCC |
| InChI | InChI=1S/C41H82N2O4/c1-5-8-11-14-18-24-31-39(30-23-17-12-9-6-2)47-41(46)33-26-20-16-22-29-36-43(37-38-44)35-28-21-15-19-25-32-40(45)42(4)34-27-13-10-7-3/h39,44H,5-38H2,1-4H3 |
| InChIKey | ZFUITLKTPBZNMO-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.12 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|