C36H71IN2O4 — CID 155720144
1-iodoundecan-6-yl 8-[2-hydroxyethyl-[6-[methyl(octyl)amino]-6-oxohexyl]amino]octanoate (PubChem CID 155720144) has the molecular formula C36H71IN2O4 and a molecular weight of 722.88 g/mol. Its IUPAC name is 1-iodoundecan-6-yl 8-[2-hydroxyethyl-[6-[methyl(octyl)amino]-6-oxohexyl]amino]octanoate.
| Compound Name | 1-iodoundecan-6-yl 8-[2-hydroxyethyl-[6-[methyl(octyl)amino]-6-oxohexyl]amino]octanoate |
|---|---|
| PubChem CID | 155720144 |
| Molecular Formula | C36H71IN2O4 |
| Molecular Weight | 722.88 g/mol |
| Exact Mass | 722.45 |
| IUPAC Name | 1-iodoundecan-6-yl 8-[2-hydroxyethyl-[6-[methyl(octyl)amino]-6-oxohexyl]amino]octanoate |
| SMILES | CCCCCCCCN(C)C(=O)CCCCCN(CCO)CCCCCCCC(=O)OC(CCCCC)CCCCCI |
| InChI | InChI=1S/C36H71IN2O4/c1-4-6-8-9-12-21-29-38(3)35(41)26-18-15-23-31-39(32-33-40)30-22-13-10-11-19-27-36(42)43-34(24-16-7-5-2)25-17-14-20-28-37/h34,40H,4-33H2,1-3H3 |
| InChIKey | KPOOLQWYLQNZEK-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.88 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|