C84H167N3O9 — CID 161496164
heptadecan-9-yl 8-[2-hydroxyethyl-[6-[methyl(octyl)amino]-6-oxohexyl]amino]octanoate;tridecan-7-yl 10-[2-hydroxyethyl-(8-nonoxy-8-oxooctyl)amino]decanoate (PubChem CID 161496164) has the molecular formula C84H167N3O9 and a molecular weight of 1363.27 g/mol. Its IUPAC name is heptadecan-9-yl 8-[2-hydroxyethyl-[6-[methyl(octyl)amino]-6-oxohexyl]amino]octanoate;tridecan-7-yl 10-[2-hydroxyethyl-(8-nonoxy-8-oxooctyl)amino]decanoate.
| Compound Name | heptadecan-9-yl 8-[2-hydroxyethyl-[6-[methyl(octyl)amino]-6-oxohexyl]amino]octanoate;tridecan-7-yl 10-[2-hydroxyethyl-(8-nonoxy-8-oxooctyl)amino]decanoate |
|---|---|
| PubChem CID | 161496164 |
| Molecular Formula | C84H167N3O9 |
| Molecular Weight | 1363.27 g/mol |
| Exact Mass | 1362.27 |
| IUPAC Name | heptadecan-9-yl 8-[2-hydroxyethyl-[6-[methyl(octyl)amino]-6-oxohexyl]amino]octanoate;tridecan-7-yl 10-[2-hydroxyethyl-(8-nonoxy-8-oxooctyl)amino]decanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCO)CCCCCC(=O)N(C)CCCCCCCC.CCCCCCCCCOC(=O)CCCCCCCN(CCO)CCCCCCCCCC(=O)OC(CCCCCC)CCCCCC |
| InChI | InChI=1S/C42H84N2O4.C42H83NO5/c1-5-8-11-14-18-24-31-40(32-25-19-15-12-9-6-2)48-42(47)34-27-20-17-22-29-36-44(38-39-45)37-30-23-26-33-41(46)43(4)35-28-21-16-13-10-7-3;1-4-7-10-13-17-23-30-39-47-41(45)33-26-20-18-22-29-36-43(37-38-44)35-28-21-16-14-15-19-27-34-42(46)48-40(31-24-11-8-5-2)32-25-12-9-6-3/h40,45H,5-39H2,1-4H3;40,44H,4-39H2,1-3H3 |
| InChIKey | WGFRRWGFGWXOEY-UHFFFAOYSA-N |
| XLogP | 23.30 |
| TPSA | 146.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 77 |
| Heavy Atoms | 96 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1363.27 |
| LogP ≤ 5 | 23.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|