C87H174N4O8 — CID 167695416
heptadecan-9-yl 8-[2-hydroxyethyl-[8-[methyl(octyl)amino]-8-oxooctyl]amino]octanoate;nonyl 8-[[8-(dioctylamino)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate (PubChem CID 167695416) has the molecular formula C87H174N4O8 and a molecular weight of 1404.37 g/mol. Its IUPAC name is heptadecan-9-yl 8-[2-hydroxyethyl-[8-[methyl(octyl)amino]-8-oxooctyl]amino]octanoate;nonyl 8-[[8-(dioctylamino)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate.
| Compound Name | heptadecan-9-yl 8-[2-hydroxyethyl-[8-[methyl(octyl)amino]-8-oxooctyl]amino]octanoate;nonyl 8-[[8-(dioctylamino)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate |
|---|---|
| PubChem CID | 167695416 |
| Molecular Formula | C87H174N4O8 |
| Molecular Weight | 1404.37 g/mol |
| Exact Mass | 1403.33 |
| IUPAC Name | heptadecan-9-yl 8-[2-hydroxyethyl-[8-[methyl(octyl)amino]-8-oxooctyl]amino]octanoate;nonyl 8-[[8-(dioctylamino)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCO)CCCCCCCC(=O)N(C)CCCCCCCC.CCCCCCCCCOC(=O)CCCCCCCN(CCO)CCCCCCCC(=O)N(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C44H88N2O4.C43H86N2O4/c1-5-8-11-14-19-26-33-42(34-27-20-15-12-9-6-2)50-44(49)36-29-22-18-25-32-39-46(40-41-47)38-31-24-17-21-28-35-43(48)45(4)37-30-23-16-13-10-7-3;1-4-7-10-13-16-25-32-41-49-43(48)34-27-20-18-22-29-36-44(39-40-46)35-28-21-17-19-26-33-42(47)45(37-30-23-14-11-8-5-2)38-31-24-15-12-9-6-3/h42,47H,5-41H2,1-4H3;46H,4-41H2,1-3H3 |
| InChIKey | XOTGINCTCULNAQ-UHFFFAOYSA-N |
| XLogP | 24.00 |
| TPSA | 140.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 80 |
| Heavy Atoms | 99 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1404.37 |
| LogP ≤ 5 | 24.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|