C47H91N5O4 — CID 139376744
nonyl 8-[3-[[amino-(cyanoamino)methylidene]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 139376744) has the molecular formula C47H91N5O4 and a molecular weight of 790.28 g/mol. Its IUPAC name is nonyl 8-[3-[[amino-(cyanoamino)methylidene]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | nonyl 8-[3-[[amino-(cyanoamino)methylidene]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 139376744 |
| Molecular Formula | C47H91N5O4 |
| Molecular Weight | 790.28 g/mol |
| Exact Mass | 789.71 |
| IUPAC Name | nonyl 8-[3-[[amino-(cyanoamino)methylidene]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCC/N=C(\N)NC#N |
| InChI | InChI=1S/C47H91N5O4/c1-4-7-10-13-16-25-32-42-55-45(53)36-28-21-17-23-30-39-52(41-33-38-50-47(49)51-43-48)40-31-24-18-22-29-37-46(54)56-44(34-26-19-14-11-8-5-2)35-27-20-15-12-9-6-3/h44H,4-42H2,1-3H3,(H3,49,50,51) |
| InChIKey | WXCHPYBZWKLWAI-UHFFFAOYSA-N |
| XLogP | 12.45 |
| TPSA | 130.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.28 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|