C49H96N4O4 — CID 159360457
nonyl 8-[[4-(cyanoamino)-4-(dimethylamino)butyl]-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 159360457) has the molecular formula C49H96N4O4 and a molecular weight of 805.33 g/mol. Its IUPAC name is nonyl 8-[[4-(cyanoamino)-4-(dimethylamino)butyl]-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | nonyl 8-[[4-(cyanoamino)-4-(dimethylamino)butyl]-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 159360457 |
| Molecular Formula | C49H96N4O4 |
| Molecular Weight | 805.33 g/mol |
| Exact Mass | 804.74 |
| IUPAC Name | nonyl 8-[[4-(cyanoamino)-4-(dimethylamino)butyl]-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCC(NC#N)N(C)C |
| InChI | InChI=1S/C49H96N4O4/c1-6-9-12-15-18-27-34-44-56-48(54)39-30-23-19-25-32-41-53(43-35-38-47(51-45-50)52(4)5)42-33-26-20-24-31-40-49(55)57-46(36-28-21-16-13-10-7-2)37-29-22-17-14-11-8-3/h46-47,51H,6-44H2,1-5H3 |
| InChIKey | GRZABFQSXTWONW-UHFFFAOYSA-N |
| XLogP | 13.41 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.33 |
| LogP ≤ 5 | 13.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|