C48H95N3O4S — CID 135329684
heptyl 7-[3-(dimethylcarbamothioylamino)propyl-(8-nonoxy-8-oxooctyl)amino]-2-octyldecanoate (PubChem CID 135329684) has the molecular formula C48H95N3O4S and a molecular weight of 810.37 g/mol. Its IUPAC name is heptyl 7-[3-(dimethylcarbamothioylamino)propyl-(8-nonoxy-8-oxooctyl)amino]-2-octyldecanoate.
| Compound Name | heptyl 7-[3-(dimethylcarbamothioylamino)propyl-(8-nonoxy-8-oxooctyl)amino]-2-octyldecanoate |
|---|---|
| PubChem CID | 135329684 |
| Molecular Formula | C48H95N3O4S |
| Molecular Weight | 810.37 g/mol |
| Exact Mass | 809.70 |
| IUPAC Name | heptyl 7-[3-(dimethylcarbamothioylamino)propyl-(8-nonoxy-8-oxooctyl)amino]-2-octyldecanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCNC(=S)N(C)C)C(CCC)CCCCC(CCCCCCCC)C(=O)OCCCCCCC |
| InChI | InChI=1S/C48H95N3O4S/c1-7-11-14-17-19-25-31-42-54-46(52)38-27-22-20-23-30-40-51(41-33-39-49-48(56)50(5)6)45(34-10-4)37-29-28-36-44(35-26-21-18-15-12-8-2)47(53)55-43-32-24-16-13-9-3/h44-45H,7-43H2,1-6H3,(H,49,56) |
| InChIKey | YCWWGTCEIUUTET-UHFFFAOYSA-N |
| XLogP | 13.36 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.37 |
| LogP ≤ 5 | 13.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|