C46H93NO5 — CID 160842819
7-[2-hydroxyethyl(10-octanoyloxydecan-2-yl)amino]heptyl 2-octyldecanoate;methane (PubChem CID 160842819) has the molecular formula C46H93NO5 and a molecular weight of 740.25 g/mol. Its IUPAC name is 7-[2-hydroxyethyl(10-octanoyloxydecan-2-yl)amino]heptyl 2-octyldecanoate;methane.
| Compound Name | 7-[2-hydroxyethyl(10-octanoyloxydecan-2-yl)amino]heptyl 2-octyldecanoate;methane |
|---|---|
| PubChem CID | 160842819 |
| Molecular Formula | C46H93NO5 |
| Molecular Weight | 740.25 g/mol |
| Exact Mass | 739.71 |
| IUPAC Name | 7-[2-hydroxyethyl(10-octanoyloxydecan-2-yl)amino]heptyl 2-octyldecanoate;methane |
| SMILES | C.CCCCCCCCC(CCCCCCCC)C(=O)OCCCCCCCN(CCO)C(C)CCCCCCCCOC(=O)CCCCCCC |
| InChI | InChI=1S/C45H89NO5.CH4/c1-5-8-11-14-21-27-34-43(35-28-22-15-12-9-6-2)45(49)51-41-32-25-18-23-30-37-46(38-39-47)42(4)33-26-20-16-17-24-31-40-50-44(48)36-29-19-13-10-7-3;/h42-43,47H,5-41H2,1-4H3;1H4 |
| InChIKey | SIGFZWMSSYWPCZ-UHFFFAOYSA-N |
| XLogP | 13.55 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.25 |
| LogP ≤ 5 | 13.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|