About 3-butylheptyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate;ethane
3-butylheptyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate;ethane (PubChem CID 178081116) has the molecular formula C45H91NO4
and a molecular weight of 710.23 g/mol. Its IUPAC name is 3-butylheptyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate;ethane.
Molecular Properties
| Compound Name | 3-butylheptyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate;ethane |
| PubChem CID | 178081116 |
| Molecular Formula | C45H91NO4 |
| Molecular Weight | 710.23 g/mol |
| Exact Mass | 709.69 |
| IUPAC Name | 3-butylheptyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate;ethane |
| SMILES | CC.CCCCCCCCC(CCCCCCC)OC(=O)CCCCCCCNCCCCCCCC(=O)OCCC(CCCC)CCCC |
| InChI | InChI=1S/C43H85NO4.C2H6/c1-5-9-13-15-19-25-33-41(32-24-18-14-10-6-2)48-43(46)35-27-21-17-23-29-38-44-37-28-22-16-20-26-34-42(45)47-39-36-40(30-11-7-3)31-12-8-4;1-2/h40-41,44H,5-39H2,1-4H3;1-2H3 |
| InChIKey | NVERWSZYCFIJNE-UHFFFAOYSA-N |
| XLogP | 14.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 710.23 |
| LogP ≤ 5 | 14.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butylheptyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butylheptyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate;ethane?
The IUPAC name of 3-butylheptyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate;ethane (CID 178081116) is 3-butylheptyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate;ethane.
What is the SMILES notation for 3-butylheptyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate;ethane?
The canonical SMILES for 3-butylheptyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate;ethane is CC.CCCCCCCCC(CCCCCCC)OC(=O)CCCCCCCNCCCCCCCC(=O)OCCC(CCCC)CCCC.
What is the InChIKey of 3-butylheptyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate;ethane?
The InChIKey is NVERWSZYCFIJNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C43H85NO4.C2H6/c1-5-9-13-15-19-25-33-41(32-24-18-14-10-6-2)48-43(46)35-27-21-17-23-29-38-44-37-28-22-16-20-26-34-42(45)47-39-36-40(30-11-7-3)31-12-8-4;1-2/h40-41,44H,5-39H2,1-4H3;1-2H3.
What are the key properties of 3-butylheptyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate;ethane?
3-butylheptyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate;ethane has a molecular weight of 710.23 g/mol, XLogP of 14.24, 39 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butylheptyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate;ethane is sourced from PubChem (CID 178081116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).