About bis(3-pentyloctyl) 9-[3-(ethylamino)propoxy]heptadecanedioate;ethane
bis(3-pentyloctyl) 9-[3-(ethylamino)propoxy]heptadecanedioate;ethane (PubChem CID 144641635) has the molecular formula C50H101NO5
and a molecular weight of 796.36 g/mol. Its IUPAC name is bis(3-pentyloctyl) 9-[3-(ethylamino)propoxy]heptadecanedioate;ethane.
Molecular Properties
| Compound Name | bis(3-pentyloctyl) 9-[3-(ethylamino)propoxy]heptadecanedioate;ethane |
| PubChem CID | 144641635 |
| Molecular Formula | C50H101NO5 |
| Molecular Weight | 796.36 g/mol |
| Exact Mass | 795.77 |
| IUPAC Name | bis(3-pentyloctyl) 9-[3-(ethylamino)propoxy]heptadecanedioate;ethane |
| SMILES | CC.CCCCCC(CCCCC)CCOC(=O)CCCCCCCC(CCCCCCCC(=O)OCCC(CCCCC)CCCCC)OCCCNCC |
| InChI | InChI=1S/C48H95NO5.C2H6/c1-6-11-21-30-44(31-22-12-7-2)38-42-53-47(50)36-27-19-15-17-25-34-46(52-41-29-40-49-10-5)35-26-18-16-20-28-37-48(51)54-43-39-45(32-23-13-8-3)33-24-14-9-4;1-2/h44-46,49H,6-43H2,1-5H3;1-2H3 |
| InChIKey | FUVUDLMYHIZOKC-UHFFFAOYSA-N |
| XLogP | 15.28 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 796.36 |
| LogP ≤ 5 | 15.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(3-pentyloctyl) 9-[3-(ethylamino)propoxy]heptadecanedioate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-pentyloctyl) 9-[3-(ethylamino)propoxy]heptadecanedioate;ethane?
The IUPAC name of bis(3-pentyloctyl) 9-[3-(ethylamino)propoxy]heptadecanedioate;ethane (CID 144641635) is bis(3-pentyloctyl) 9-[3-(ethylamino)propoxy]heptadecanedioate;ethane.
What is the SMILES notation for bis(3-pentyloctyl) 9-[3-(ethylamino)propoxy]heptadecanedioate;ethane?
The canonical SMILES for bis(3-pentyloctyl) 9-[3-(ethylamino)propoxy]heptadecanedioate;ethane is CC.CCCCCC(CCCCC)CCOC(=O)CCCCCCCC(CCCCCCCC(=O)OCCC(CCCCC)CCCCC)OCCCNCC.
What is the InChIKey of bis(3-pentyloctyl) 9-[3-(ethylamino)propoxy]heptadecanedioate;ethane?
The InChIKey is FUVUDLMYHIZOKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C48H95NO5.C2H6/c1-6-11-21-30-44(31-22-12-7-2)38-42-53-47(50)36-27-19-15-17-25-34-46(52-41-29-40-49-10-5)35-26-18-16-20-28-37-48(51)54-43-39-45(32-23-13-8-3)33-24-14-9-4;1-2/h44-46,49H,6-43H2,1-5H3;1-2H3.
What are the key properties of bis(3-pentyloctyl) 9-[3-(ethylamino)propoxy]heptadecanedioate;ethane?
bis(3-pentyloctyl) 9-[3-(ethylamino)propoxy]heptadecanedioate;ethane has a molecular weight of 796.36 g/mol, XLogP of 15.28, 44 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-pentyloctyl) 9-[3-(ethylamino)propoxy]heptadecanedioate;ethane is sourced from PubChem (CID 144641635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).