C48H92N2O5 — CID 167181016
3-butylheptyl 8-[3-[(1-methylcyclopropanecarbonyl)amino]propyl-[8-oxo-8-(3-pentyloctoxy)octyl]amino]octanoate (PubChem CID 167181016) has the molecular formula C48H92N2O5 and a molecular weight of 777.27 g/mol. Its IUPAC name is 3-butylheptyl 8-[3-[(1-methylcyclopropanecarbonyl)amino]propyl-[8-oxo-8-(3-pentyloctoxy)octyl]amino]octanoate.
| Compound Name | 3-butylheptyl 8-[3-[(1-methylcyclopropanecarbonyl)amino]propyl-[8-oxo-8-(3-pentyloctoxy)octyl]amino]octanoate |
|---|---|
| PubChem CID | 167181016 |
| Molecular Formula | C48H92N2O5 |
| Molecular Weight | 777.27 g/mol |
| Exact Mass | 776.70 |
| IUPAC Name | 3-butylheptyl 8-[3-[(1-methylcyclopropanecarbonyl)amino]propyl-[8-oxo-8-(3-pentyloctoxy)octyl]amino]octanoate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCCN(CCCCCCCC(=O)OCCC(CCCC)CCCC)CCCNC(=O)C1(C)CC1 |
| InChI | InChI=1S/C48H92N2O5/c1-6-10-20-29-44(30-21-11-7-2)34-42-55-46(52)32-23-17-15-19-25-39-50(40-26-37-49-47(53)48(5)35-36-48)38-24-18-14-16-22-31-45(51)54-41-33-43(27-12-8-3)28-13-9-4/h43-44H,6-42H2,1-5H3,(H,49,53) |
| InChIKey | ZODUITSYIRBHTO-UHFFFAOYSA-N |
| XLogP | 12.92 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.27 |
| LogP ≤ 5 | 12.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|