C46H92N2O6S — CID 176570643
3-butylheptyl 8-[3-(2-methoxyethylsulfinylamino)propyl-[8-oxo-8-(3-pentyloctoxy)octyl]amino]octanoate (PubChem CID 176570643) has the molecular formula C46H92N2O6S and a molecular weight of 801.32 g/mol. Its IUPAC name is 3-butylheptyl 8-[3-(2-methoxyethylsulfinylamino)propyl-[8-oxo-8-(3-pentyloctoxy)octyl]amino]octanoate.
| Compound Name | 3-butylheptyl 8-[3-(2-methoxyethylsulfinylamino)propyl-[8-oxo-8-(3-pentyloctoxy)octyl]amino]octanoate |
|---|---|
| PubChem CID | 176570643 |
| Molecular Formula | C46H92N2O6S |
| Molecular Weight | 801.32 g/mol |
| Exact Mass | 800.67 |
| IUPAC Name | 3-butylheptyl 8-[3-(2-methoxyethylsulfinylamino)propyl-[8-oxo-8-(3-pentyloctoxy)octyl]amino]octanoate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCCN(CCCCCCCC(=O)OCCC(CCCC)CCCC)CCCNS(=O)CCOC |
| InChI | InChI=1S/C46H92N2O6S/c1-6-10-20-29-44(30-21-11-7-2)34-40-54-46(50)32-23-17-15-19-25-37-48(38-26-35-47-55(51)42-41-52-5)36-24-18-14-16-22-31-45(49)53-39-33-43(27-12-8-3)28-13-9-4/h43-44,47H,6-42H2,1-5H3 |
| InChIKey | DUPRZWZIRREIRK-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.32 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|