C45H90N2O6S — CID 167181023
3-butylheptyl 8-[3-(ethylsulfonylamino)propyl-[8-oxo-8-(3-pentyloctoxy)octyl]amino]octanoate (PubChem CID 167181023) has the molecular formula C45H90N2O6S and a molecular weight of 787.29 g/mol. Its IUPAC name is 3-butylheptyl 8-[3-(ethylsulfonylamino)propyl-[8-oxo-8-(3-pentyloctoxy)octyl]amino]octanoate.
| Compound Name | 3-butylheptyl 8-[3-(ethylsulfonylamino)propyl-[8-oxo-8-(3-pentyloctoxy)octyl]amino]octanoate |
|---|---|
| PubChem CID | 167181023 |
| Molecular Formula | C45H90N2O6S |
| Molecular Weight | 787.29 g/mol |
| Exact Mass | 786.65 |
| IUPAC Name | 3-butylheptyl 8-[3-(ethylsulfonylamino)propyl-[8-oxo-8-(3-pentyloctoxy)octyl]amino]octanoate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCCN(CCCCCCCC(=O)OCCC(CCCC)CCCC)CCCNS(=O)(=O)CC |
| InChI | InChI=1S/C45H90N2O6S/c1-6-11-21-30-43(31-22-12-7-2)35-41-53-45(49)33-24-18-16-20-26-38-47(39-27-36-46-54(50,51)10-5)37-25-19-15-17-23-32-44(48)52-40-34-42(28-13-8-3)29-14-9-4/h42-43,46H,6-41H2,1-5H3 |
| InChIKey | XBXZAPKRXSMPTO-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.29 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|