C54H104N2O5 — CID 170754917
3-butylheptyl 8-[8-heptadecan-9-yloxynon-8-enyl-[3-[(3-methyloxolane-3-carbonyl)amino]propyl]amino]octanoate (PubChem CID 170754917) has the molecular formula C54H104N2O5 and a molecular weight of 861.43 g/mol. Its IUPAC name is 3-butylheptyl 8-[8-heptadecan-9-yloxynon-8-enyl-[3-[(3-methyloxolane-3-carbonyl)amino]propyl]amino]octanoate.
| Compound Name | 3-butylheptyl 8-[8-heptadecan-9-yloxynon-8-enyl-[3-[(3-methyloxolane-3-carbonyl)amino]propyl]amino]octanoate |
|---|---|
| PubChem CID | 170754917 |
| Molecular Formula | C54H104N2O5 |
| Molecular Weight | 861.43 g/mol |
| Exact Mass | 860.79 |
| IUPAC Name | 3-butylheptyl 8-[8-heptadecan-9-yloxynon-8-enyl-[3-[(3-methyloxolane-3-carbonyl)amino]propyl]amino]octanoate |
| SMILES | C=C(CCCCCCCN(CCCCCCCC(=O)OCCC(CCCC)CCCC)CCCNC(=O)C1(C)CCOC1)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C54H104N2O5/c1-7-11-15-17-22-28-37-51(38-29-23-18-16-12-8-2)61-49(5)34-27-21-19-25-31-43-56(45-33-42-55-53(58)54(6)41-47-59-48-54)44-32-26-20-24-30-39-52(57)60-46-40-50(35-13-9-3)36-14-10-4/h50-51H,5,7-48H2,1-4,6H3,(H,55,58) |
| InChIKey | KZHORJGMCMEBTM-UHFFFAOYSA-N |
| XLogP | 15.23 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.43 |
| LogP ≤ 5 | 15.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|