C57H112N2O6 — CID 177194016
heptadecan-9-yl 8-[8-(3-butylheptoxy)non-8-enyl-[3-[(3-hydroxy-2-methylpropanoyl)amino]propyl]amino]octanoate;pentan-2-one (PubChem CID 177194016) has the molecular formula C57H112N2O6 and a molecular weight of 921.53 g/mol. Its IUPAC name is heptadecan-9-yl 8-[8-(3-butylheptoxy)non-8-enyl-[3-[(3-hydroxy-2-methylpropanoyl)amino]propyl]amino]octanoate;pentan-2-one.
| Compound Name | heptadecan-9-yl 8-[8-(3-butylheptoxy)non-8-enyl-[3-[(3-hydroxy-2-methylpropanoyl)amino]propyl]amino]octanoate;pentan-2-one |
|---|---|
| PubChem CID | 177194016 |
| Molecular Formula | C57H112N2O6 |
| Molecular Weight | 921.53 g/mol |
| Exact Mass | 920.85 |
| IUPAC Name | heptadecan-9-yl 8-[8-(3-butylheptoxy)non-8-enyl-[3-[(3-hydroxy-2-methylpropanoyl)amino]propyl]amino]octanoate;pentan-2-one |
| SMILES | C=C(CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCNC(=O)C(C)CO)OCCC(CCCC)CCCC.CCCC(C)=O |
| InChI | InChI=1S/C52H102N2O5.C5H10O/c1-7-11-15-17-22-28-37-50(38-29-23-18-16-12-8-2)59-51(56)39-30-24-20-26-32-43-54(44-33-41-53-52(57)47(5)46-55)42-31-25-19-21-27-34-48(6)58-45-40-49(35-13-9-3)36-14-10-4;1-3-4-5(2)6/h47,49-50,55H,6-46H2,1-5H3,(H,53,57);3-4H2,1-2H3 |
| InChIKey | NTXZSTDGSRYXDG-UHFFFAOYSA-N |
| XLogP | 15.81 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.53 |
| LogP ≤ 5 | 15.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|