C49H96N2O5 — CID 142378824
heptadecan-9-yl 8-[3-[methoxycarbonyl(methyl)amino]propyl-(8-nonoxynon-8-enyl)amino]octanoate (PubChem CID 142378824) has the molecular formula C49H96N2O5 and a molecular weight of 793.32 g/mol. Its IUPAC name is heptadecan-9-yl 8-[3-[methoxycarbonyl(methyl)amino]propyl-(8-nonoxynon-8-enyl)amino]octanoate.
| Compound Name | heptadecan-9-yl 8-[3-[methoxycarbonyl(methyl)amino]propyl-(8-nonoxynon-8-enyl)amino]octanoate |
|---|---|
| PubChem CID | 142378824 |
| Molecular Formula | C49H96N2O5 |
| Molecular Weight | 793.32 g/mol |
| Exact Mass | 792.73 |
| IUPAC Name | heptadecan-9-yl 8-[3-[methoxycarbonyl(methyl)amino]propyl-(8-nonoxynon-8-enyl)amino]octanoate |
| SMILES | C=C(CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCN(C)C(=O)OC)OCCCCCCCCC |
| InChI | InChI=1S/C49H96N2O5/c1-7-10-13-16-19-28-35-45-55-46(4)37-29-22-20-26-33-42-51(44-36-41-50(5)49(53)54-6)43-34-27-21-25-32-40-48(52)56-47(38-30-23-17-14-11-8-2)39-31-24-18-15-12-9-3/h47H,4,7-45H2,1-3,5-6H3 |
| InChIKey | QQDYYWBEHGXOSD-UHFFFAOYSA-N |
| XLogP | 14.75 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.32 |
| LogP ≤ 5 | 14.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|