C39H76N2O5 — CID 167418943
heptyl 8-[3-[acetyl(methyl)amino]propyl-(8-decan-5-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 167418943) has the molecular formula C39H76N2O5 and a molecular weight of 653.05 g/mol. Its IUPAC name is heptyl 8-[3-[acetyl(methyl)amino]propyl-(8-decan-5-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | heptyl 8-[3-[acetyl(methyl)amino]propyl-(8-decan-5-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 167418943 |
| Molecular Formula | C39H76N2O5 |
| Molecular Weight | 653.05 g/mol |
| Exact Mass | 652.58 |
| IUPAC Name | heptyl 8-[3-[acetyl(methyl)amino]propyl-(8-decan-5-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCC)CCCCC)CCCN(C)C(C)=O |
| InChI | InChI=1S/C39H76N2O5/c1-6-9-12-19-25-35-45-38(43)29-21-15-13-17-23-32-41(34-26-31-40(5)36(4)42)33-24-18-14-16-22-30-39(44)46-37(27-11-8-3)28-20-10-7-2/h37H,6-35H2,1-5H3 |
| InChIKey | UXRKICNXDCMYQR-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.05 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|