C38H74N2O6 — CID 167418896
heptyl 8-[3-[acetyl(hydroxy)amino]propyl-(8-decan-5-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 167418896) has the molecular formula C38H74N2O6 and a molecular weight of 655.02 g/mol. Its IUPAC name is heptyl 8-[3-[acetyl(hydroxy)amino]propyl-(8-decan-5-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | heptyl 8-[3-[acetyl(hydroxy)amino]propyl-(8-decan-5-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 167418896 |
| Molecular Formula | C38H74N2O6 |
| Molecular Weight | 655.02 g/mol |
| Exact Mass | 654.55 |
| IUPAC Name | heptyl 8-[3-[acetyl(hydroxy)amino]propyl-(8-decan-5-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCC)CCCCC)CCCN(O)C(C)=O |
| InChI | InChI=1S/C38H74N2O6/c1-5-8-11-18-24-34-45-37(42)28-20-14-12-16-22-30-39(32-25-33-40(44)35(4)41)31-23-17-13-15-21-29-38(43)46-36(26-10-7-3)27-19-9-6-2/h36,44H,5-34H2,1-4H3 |
| InChIKey | MTZGSBLPFFLWPI-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.02 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|