C49H95F3N2O6 — CID 175996987
3-butylheptyl 8-[3-aminopropyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate;2,2,2-trifluoroacetic acid (PubChem CID 175996987) has the molecular formula C49H95F3N2O6 and a molecular weight of 865.30 g/mol. Its IUPAC name is 3-butylheptyl 8-[3-aminopropyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate;2,2,2-trifluoroacetic acid.
| Compound Name | 3-butylheptyl 8-[3-aminopropyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175996987 |
| Molecular Formula | C49H95F3N2O6 |
| Molecular Weight | 865.30 g/mol |
| Exact Mass | 864.71 |
| IUPAC Name | 3-butylheptyl 8-[3-aminopropyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCN)CCCCCCCC(=O)OCCC(CCCC)CCCC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C47H94N2O4.C2HF3O2/c1-5-9-13-15-19-25-34-45(35-26-20-16-14-10-6-2)53-47(51)37-28-22-18-24-30-41-49(42-31-39-48)40-29-23-17-21-27-36-46(50)52-43-38-44(32-11-7-3)33-12-8-4;3-2(4,5)1(6)7/h44-45H,5-43,48H2,1-4H3;(H,6,7) |
| InChIKey | ONYKWCNBROQDMV-UHFFFAOYSA-N |
| XLogP | 14.29 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.30 |
| LogP ≤ 5 | 14.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|