C47H91N5O5 — CID 167180906
3-butylheptyl 8-[3-[(5-amino-1,2,4-oxadiazol-3-yl)amino]propyl-(8-oxo-8-pentadecan-8-yloxyoctyl)amino]octanoate (PubChem CID 167180906) has the molecular formula C47H91N5O5 and a molecular weight of 806.27 g/mol. Its IUPAC name is 3-butylheptyl 8-[3-[(5-amino-1,2,4-oxadiazol-3-yl)amino]propyl-(8-oxo-8-pentadecan-8-yloxyoctyl)amino]octanoate.
| Compound Name | 3-butylheptyl 8-[3-[(5-amino-1,2,4-oxadiazol-3-yl)amino]propyl-(8-oxo-8-pentadecan-8-yloxyoctyl)amino]octanoate |
|---|---|
| PubChem CID | 167180906 |
| Molecular Formula | C47H91N5O5 |
| Molecular Weight | 806.27 g/mol |
| Exact Mass | 805.70 |
| IUPAC Name | 3-butylheptyl 8-[3-[(5-amino-1,2,4-oxadiazol-3-yl)amino]propyl-(8-oxo-8-pentadecan-8-yloxyoctyl)amino]octanoate |
| SMILES | CCCCCCCC(CCCCCCC)OC(=O)CCCCCCCN(CCCCCCCC(=O)OCCC(CCCC)CCCC)CCCNc1noc(N)n1 |
| InChI | InChI=1S/C47H91N5O5/c1-5-9-13-17-23-32-43(33-24-18-14-10-6-2)56-45(54)35-26-20-16-22-28-39-52(40-29-37-49-47-50-46(48)57-51-47)38-27-21-15-19-25-34-44(53)55-41-36-42(30-11-7-3)31-12-8-4/h42-43H,5-41H2,1-4H3,(H3,48,49,50,51) |
| InChIKey | IWOVVKGBWSQIGH-UHFFFAOYSA-N |
| XLogP | 13.00 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.27 |
| LogP ≤ 5 | 13.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|